What is the 2-FLUOROPROPENE?

2-FLUOROPROPENE is , while it's Molecular Formula is C3H5 F. Used in Chemical Synthesis: 2-Fluoropropene is used as a building block in the synthesis of other organic compounds, contributing to the creation of a wide range of chemical products due to its unique fluorinated structure. Used in Polymer and Copolymer Production: In the polymer industry, 2-fluoropropene is utilized as a monomer in the production of certain polymers and copolymers. Its presence in these materials can enhance properties such as heat resistance and chemical stability. Used as a Refrigerant: 2-Fluoropropene is employed as a refrigerant in various cooling systems. Its properties make it a suitable alternative to traditional refrigerants, potentially offering environmental benefits such as lower global warming potential. Used in Manufacturing of Other Chemicals: As a precursor, 2-fluoropropene plays a crucial role in the manufacturing process of other chemicals, where its reactivity and unique chemical structure are leveraged to produce desired end products. Used in the Pharmaceutical Industry: Although not explicitly mentioned in the provided materials, 2-fluoropropene, due to its fluorinated nature, could potentially be used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients or as an intermediate in drug manufacturing processes.

What is the CAS number for 2-FLUOROPROPENE?

The CAS number of 2-FLUOROPROPENE is 1184-60-7.

What is 2-FLUOROPROPENE (1184-60-7) used for?

2-Fluoropropene, also known as 2-fluoropropylene, is an organic compound characterized by the chemical formula C3H5F. It is a colorless, flammable gas with a faint, sweet odor. 2-FLUOROPROPENE is notable for its applications in the chemical industry, particularly in the production of polymers, copolymers, and other organic compounds, as well as serving as a refrigerant and a precursor in the manufacturing of various chemicals. However, due to its flammability and potential health hazards, 2-fluoropropene is classified as a hazardous substance that requires careful handling.InChI:InChI=1/C3H5F/c1-3(2)4/h1H2,2H3

What is the 2-FLUOROPROPENE?

2-FLUOROPROPENE is , while it's Molecular Formula is C3H5 F. Used in Chemical Synthesis: 2-Fluoropropene is used as a building block in the synthesis of other organic compounds, contributing to the creation of a wide range of chemical products due to its unique fluorinated structure. Used in Polymer and Copolymer Production: In the polymer industry, 2-fluoropropene is utilized as a monomer in the production of certain polymers and copolymers. Its presence in these materials can enhance properties such as heat resistance and chemical stability. Used as a Refrigerant: 2-Fluoropropene is employed as a refrigerant in various cooling systems. Its properties make it a suitable alternative to traditional refrigerants, potentially offering environmental benefits such as lower global warming potential. Used in Manufacturing of Other Chemicals: As a precursor, 2-fluoropropene plays a crucial role in the manufacturing process of other chemicals, where its reactivity and unique chemical structure are leveraged to produce desired end products. Used in the Pharmaceutical Industry: Although not explicitly mentioned in the provided materials, 2-fluoropropene, due to its fluorinated nature, could potentially be used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients or as an intermediate in drug manufacturing processes.

What is the CAS number for 2-FLUOROPROPENE?

The CAS number of 2-FLUOROPROPENE is 1184-60-7.

What is 2-FLUOROPROPENE (1184-60-7) used for?

2-Fluoropropene, also known as 2-fluoropropylene, is an organic compound characterized by the chemical formula C3H5F. It is a colorless, flammable gas with a faint, sweet odor. 2-FLUOROPROPENE is notable for its applications in the chemical industry, particularly in the production of polymers, copolymers, and other organic compounds, as well as serving as a refrigerant and a precursor in the manufacturing of various chemicals. However, due to its flammability and potential health hazards, 2-fluoropropene is classified as a hazardous substance that requires careful handling.InChI:InChI=1/C3H5F/c1-3(2)4/h1H2,2H3

Top quality factory supply 1184-60-7 2-FLUOROPROPENE at low price

Home >Others > 2-FLUOROPROPENE

Chemical Name: 2-FLUOROPROPENE
CAS No.: 1184-60-7

Top quality factory supply 1184-60-7 2-FLUOROPROPENE at low price

Molecular Formula: C3H5 F
Molecular Weight: 60.0711
Vapor Pressure: 4010mmHg at 25°C
Refractive Index: 1.3800
Boiling Point: °Cat760mmHg
Flash Point: °C
PSA： 0.00000
Density: 0.766g/cm³
LogP: 1.48950

2-FLUOROPROPENE(Cas 1184-60-7) Usage

General Description

2-Fluoropropene, also known as 2-fluoropropylene, is an organic compound with the chemical formula C3H5F. It is a colorless, flammable gas with a faint, sweet odor. 2-Fluoropropene is used in the production of certain polymers and copolymers, as well as in the synthesis of other organic compounds. It is also used as a refrigerant and as a precursor in the manufacturing of other chemicals. However, 2-fluoropropene is considered to be a hazardous substance and should be handled with caution due to its flammability and potential health hazards. Additionally,

InChI:InChI=1/C3H5F/c1-3(2)4/h1H2,2H3